C31H39NO7S2 — CID 118361824
[2-[1-cyano-2-(3-methoxybutoxy)-2-oxoethylidene]-4-(4-methylcyclohexanecarbonyl)oxy-1,3-benzodithiol-7-yl] 4-methylcyclohexane-1-carboxylate (PubChem CID 118361824) has the molecular formula C31H39NO7S2 and a molecular weight of 601.79 g/mol. Its IUPAC name is [2-[1-cyano-2-(3-methoxybutoxy)-2-oxoethylidene]-4-(4-methylcyclohexanecarbonyl)oxy-1,3-benzodithiol-7-yl] 4-methylcyclohexane-1-carboxylate.
| Compound Name | [2-[1-cyano-2-(3-methoxybutoxy)-2-oxoethylidene]-4-(4-methylcyclohexanecarbonyl)oxy-1,3-benzodithiol-7-yl] 4-methylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 118361824 |
| Molecular Formula | C31H39NO7S2 |
| Molecular Weight | 601.79 g/mol |
| Exact Mass | 601.22 |
| IUPAC Name | [2-[1-cyano-2-(3-methoxybutoxy)-2-oxoethylidene]-4-(4-methylcyclohexanecarbonyl)oxy-1,3-benzodithiol-7-yl] 4-methylcyclohexane-1-carboxylate |
| SMILES | COC(C)CCOC(=O)C(C#N)=C1Sc2c(OC(=O)C3CCC(C)CC3)ccc(OC(=O)C3CCC(C)CC3)c2S1 |
| InChI | InChI=1S/C31H39NO7S2/c1-18-5-9-21(10-6-18)28(33)38-24-13-14-25(39-29(34)22-11-7-19(2)8-12-22)27-26(24)40-31(41-27)23(17-32)30(35)37-16-15-20(3)36-4/h13-14,18-22H,5-12,15-16H2,1-4H3 |
| InChIKey | GTXMYXOUKZTWQE-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 111.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.79 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|