C29H35NO8S2 — CID 88560516
[2-(1-cyano-2-oxo-2-propan-2-yloxyethylidene)-4-(4-methoxycyclohexanecarbonyl)oxy-1,3-benzodithiol-7-yl] 4-methoxycyclohexane-1-carboxylate (PubChem CID 88560516) has the molecular formula C29H35NO8S2 and a molecular weight of 589.73 g/mol. Its IUPAC name is [2-(1-cyano-2-oxo-2-propan-2-yloxyethylidene)-4-(4-methoxycyclohexanecarbonyl)oxy-1,3-benzodithiol-7-yl] 4-methoxycyclohexane-1-carboxylate.
| Compound Name | [2-(1-cyano-2-oxo-2-propan-2-yloxyethylidene)-4-(4-methoxycyclohexanecarbonyl)oxy-1,3-benzodithiol-7-yl] 4-methoxycyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 88560516 |
| Molecular Formula | C29H35NO8S2 |
| Molecular Weight | 589.73 g/mol |
| Exact Mass | 589.18 |
| IUPAC Name | [2-(1-cyano-2-oxo-2-propan-2-yloxyethylidene)-4-(4-methoxycyclohexanecarbonyl)oxy-1,3-benzodithiol-7-yl] 4-methoxycyclohexane-1-carboxylate |
| SMILES | COC1CCC(C(=O)Oc2ccc(OC(=O)C3CCC(OC)CC3)c3c2SC(=C(C#N)C(=O)OC(C)C)S3)CC1 |
| InChI | InChI=1S/C29H35NO8S2/c1-16(2)36-28(33)21(15-30)29-39-24-22(37-26(31)17-5-9-19(34-3)10-6-17)13-14-23(25(24)40-29)38-27(32)18-7-11-20(35-4)12-8-18/h13-14,16-20H,5-12H2,1-4H3 |
| InChIKey | VXYIPRXGLJLOJU-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 121.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.73 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|