C27H32N2O5S2 — CID 58445451
[2-[1-isocyano-2-(methylamino)-2-oxoethylidene]-4-(4-methylcyclohexanecarbonyl)oxy-1,3-benzodithiol-7-yl] 4-methylcyclohexane-1-carboxylate (PubChem CID 58445451) has the molecular formula C27H32N2O5S2 and a molecular weight of 528.70 g/mol. Its IUPAC name is [2-[1-isocyano-2-(methylamino)-2-oxoethylidene]-4-(4-methylcyclohexanecarbonyl)oxy-1,3-benzodithiol-7-yl] 4-methylcyclohexane-1-carboxylate.
| Compound Name | [2-[1-isocyano-2-(methylamino)-2-oxoethylidene]-4-(4-methylcyclohexanecarbonyl)oxy-1,3-benzodithiol-7-yl] 4-methylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 58445451 |
| Molecular Formula | C27H32N2O5S2 |
| Molecular Weight | 528.70 g/mol |
| Exact Mass | 528.18 |
| IUPAC Name | [2-[1-isocyano-2-(methylamino)-2-oxoethylidene]-4-(4-methylcyclohexanecarbonyl)oxy-1,3-benzodithiol-7-yl] 4-methylcyclohexane-1-carboxylate |
| SMILES | [C-]#[N+]C(C(=O)NC)=C1Sc2c(OC(=O)C3CCC(C)CC3)ccc(OC(=O)C3CCC(C)CC3)c2S1 |
| InChI | InChI=1S/C27H32N2O5S2/c1-15-5-9-17(10-6-15)25(31)33-19-13-14-20(34-26(32)18-11-7-16(2)8-12-18)23-22(19)35-27(36-23)21(28-3)24(30)29-4/h13-18H,5-12H2,1-2,4H3,(H,29,30) |
| InChIKey | BUUQYAGYQBUWBM-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 86.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.70 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|