C39H50N2O7S2 — CID 59501854
[4-[4-(4-methylcyclohexyl)cyclohexanecarbonyl]oxy-2-(2,4,6-trioxo-1,3-diazinan-5-ylidene)-1,3-benzodithiol-7-yl] 4-(4-methylcyclohexyl)cyclohexane-1-carboxylate (PubChem CID 59501854) has the molecular formula C39H50N2O7S2 and a molecular weight of 722.97 g/mol. Its IUPAC name is [4-[4-(4-methylcyclohexyl)cyclohexanecarbonyl]oxy-2-(2,4,6-trioxo-1,3-diazinan-5-ylidene)-1,3-benzodithiol-7-yl] 4-(4-methylcyclohexyl)cyclohexane-1-carboxylate.
| Compound Name | [4-[4-(4-methylcyclohexyl)cyclohexanecarbonyl]oxy-2-(2,4,6-trioxo-1,3-diazinan-5-ylidene)-1,3-benzodithiol-7-yl] 4-(4-methylcyclohexyl)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 59501854 |
| Molecular Formula | C39H50N2O7S2 |
| Molecular Weight | 722.97 g/mol |
| Exact Mass | 722.31 |
| IUPAC Name | [4-[4-(4-methylcyclohexyl)cyclohexanecarbonyl]oxy-2-(2,4,6-trioxo-1,3-diazinan-5-ylidene)-1,3-benzodithiol-7-yl] 4-(4-methylcyclohexyl)cyclohexane-1-carboxylate |
| SMILES | CC1CCC(C2CCC(C(=O)Oc3ccc(OC(=O)C4CCC(C5CCC(C)CC5)CC4)c4c3SC(=C3C(=O)NC(=O)NC3=O)S4)CC2)CC1 |
| InChI | InChI=1S/C39H50N2O7S2/c1-21-3-7-23(8-4-21)25-11-15-27(16-12-25)36(44)47-29-19-20-30(33-32(29)49-38(50-33)31-34(42)40-39(46)41-35(31)43)48-37(45)28-17-13-26(14-18-28)24-9-5-22(2)6-10-24/h19-28H,3-18H2,1-2H3,(H2,40,41,42,43,46) |
| InChIKey | NJQINBQWSVHMRF-UHFFFAOYSA-N |
| XLogP | 8.54 |
| TPSA | 127.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.97 |
| LogP ≤ 5 | 8.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|