C28H34O6S2 — CID 58445477
[2-(2,4-dioxopentan-3-ylidene)-4-(4-methylcyclohexanecarbonyl)oxy-1,3-benzodithiol-7-yl] 4-methylcyclohexane-1-carboxylate (PubChem CID 58445477) has the molecular formula C28H34O6S2 and a molecular weight of 530.71 g/mol. Its IUPAC name is [2-(2,4-dioxopentan-3-ylidene)-4-(4-methylcyclohexanecarbonyl)oxy-1,3-benzodithiol-7-yl] 4-methylcyclohexane-1-carboxylate.
| Compound Name | [2-(2,4-dioxopentan-3-ylidene)-4-(4-methylcyclohexanecarbonyl)oxy-1,3-benzodithiol-7-yl] 4-methylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 58445477 |
| Molecular Formula | C28H34O6S2 |
| Molecular Weight | 530.71 g/mol |
| Exact Mass | 530.18 |
| IUPAC Name | [2-(2,4-dioxopentan-3-ylidene)-4-(4-methylcyclohexanecarbonyl)oxy-1,3-benzodithiol-7-yl] 4-methylcyclohexane-1-carboxylate |
| SMILES | CC(=O)C(C(C)=O)=C1Sc2c(OC(=O)C3CCC(C)CC3)ccc(OC(=O)C3CCC(C)CC3)c2S1 |
| InChI | InChI=1S/C28H34O6S2/c1-15-5-9-19(10-6-15)26(31)33-21-13-14-22(34-27(32)20-11-7-16(2)8-12-20)25-24(21)35-28(36-25)23(17(3)29)18(4)30/h13-16,19-20H,5-12H2,1-4H3 |
| InChIKey | AXVXCGMMNJXDKP-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.71 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|