C29H40N2O7S2 — CID 176804735
4-[[(2E)-2-(2-amino-1-isocyano-2-oxoethylidene)-5-methyl-4-[4-(2-methylbutanoyloxy)butoxy]-1,3-benzodithiol-7-yl]oxy]butyl 2-methylbutanoate (PubChem CID 176804735) has the molecular formula C29H40N2O7S2 and a molecular weight of 592.78 g/mol. Its IUPAC name is 4-[[(2E)-2-(2-amino-1-isocyano-2-oxoethylidene)-5-methyl-4-[4-(2-methylbutanoyloxy)butoxy]-1,3-benzodithiol-7-yl]oxy]butyl 2-methylbutanoate.
| Compound Name | 4-[[(2E)-2-(2-amino-1-isocyano-2-oxoethylidene)-5-methyl-4-[4-(2-methylbutanoyloxy)butoxy]-1,3-benzodithiol-7-yl]oxy]butyl 2-methylbutanoate |
|---|---|
| PubChem CID | 176804735 |
| Molecular Formula | C29H40N2O7S2 |
| Molecular Weight | 592.78 g/mol |
| Exact Mass | 592.23 |
| IUPAC Name | 4-[[(2E)-2-(2-amino-1-isocyano-2-oxoethylidene)-5-methyl-4-[4-(2-methylbutanoyloxy)butoxy]-1,3-benzodithiol-7-yl]oxy]butyl 2-methylbutanoate |
| SMILES | [C-]#[N+]/C(C(N)=O)=C1\Sc2c(OCCCCOC(=O)C(C)CC)cc(C)c(OCCCCOC(=O)C(C)CC)c2S1 |
| InChI | InChI=1S/C29H40N2O7S2/c1-7-18(3)27(33)37-15-11-9-13-35-21-17-20(5)23(36-14-10-12-16-38-28(34)19(4)8-2)25-24(21)39-29(40-25)22(31-6)26(30)32/h17-19H,7-16H2,1-5H3,(H2,30,32)/b29-22+ |
| InChIKey | QWHOMZSZBFZGJK-QUPMIFSKSA-N |
| XLogP | 6.26 |
| TPSA | 118.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.78 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|