C26H40N4O3 — CID 166052271
10-[2,5-dimethyl-4-[(E)-1,2,4-triazol-4-yliminomethyl]phenoxy]decyl 2-methylbutanoate (PubChem CID 166052271) has the molecular formula C26H40N4O3 and a molecular weight of 456.63 g/mol. Its IUPAC name is 10-[2,5-dimethyl-4-[(E)-1,2,4-triazol-4-yliminomethyl]phenoxy]decyl 2-methylbutanoate.
| Compound Name | 10-[2,5-dimethyl-4-[(E)-1,2,4-triazol-4-yliminomethyl]phenoxy]decyl 2-methylbutanoate |
|---|---|
| PubChem CID | 166052271 |
| Molecular Formula | C26H40N4O3 |
| Molecular Weight | 456.63 g/mol |
| Exact Mass | 456.31 |
| IUPAC Name | 10-[2,5-dimethyl-4-[(E)-1,2,4-triazol-4-yliminomethyl]phenoxy]decyl 2-methylbutanoate |
| SMILES | CCC(C)C(=O)OCCCCCCCCCCOc1cc(C)c(/C=N/n2cnnc2)cc1C |
| InChI | InChI=1S/C26H40N4O3/c1-5-21(2)26(31)33-15-13-11-9-7-6-8-10-12-14-32-25-17-22(3)24(16-23(25)4)18-29-30-19-27-28-20-30/h16-21H,5-15H2,1-4H3/b29-18+ |
| InChIKey | UNYSLEPCACADQO-RDRPBHBLSA-N |
| XLogP | 5.87 |
| TPSA | 78.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.63 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|