C20H18N2O6S2 — CID 154953544
2-[[7-(2-acetyloxyethoxy)-2-(dicyanomethylidene)-5-methyl-1,3-benzodithiol-4-yl]oxy]ethyl prop-2-enoate (PubChem CID 154953544) has the molecular formula C20H18N2O6S2 and a molecular weight of 446.51 g/mol. Its IUPAC name is 2-[[7-(2-acetyloxyethoxy)-2-(dicyanomethylidene)-5-methyl-1,3-benzodithiol-4-yl]oxy]ethyl prop-2-enoate.
| Compound Name | 2-[[7-(2-acetyloxyethoxy)-2-(dicyanomethylidene)-5-methyl-1,3-benzodithiol-4-yl]oxy]ethyl prop-2-enoate |
|---|---|
| PubChem CID | 154953544 |
| Molecular Formula | C20H18N2O6S2 |
| Molecular Weight | 446.51 g/mol |
| Exact Mass | 446.06 |
| IUPAC Name | 2-[[7-(2-acetyloxyethoxy)-2-(dicyanomethylidene)-5-methyl-1,3-benzodithiol-4-yl]oxy]ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCOc1c(C)cc(OCCOC(C)=O)c2c1SC(=C(C#N)C#N)S2 |
| InChI | InChI=1S/C20H18N2O6S2/c1-4-16(24)27-7-8-28-17-12(2)9-15(26-6-5-25-13(3)23)18-19(17)30-20(29-18)14(10-21)11-22/h4,9H,1,5-8H2,2-3H3 |
| InChIKey | GVVGFXUYCGZIMP-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 118.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.51 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'ene_cyano_D(3)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|