C25H32O6 — CID 126731074
2-[4-[[4-(2-acetyloxyethoxy)-3,5-dimethylphenyl]methyl]-2,6-dimethylphenoxy]ethyl acetate (PubChem CID 126731074) has the molecular formula C25H32O6 and a molecular weight of 428.53 g/mol. Its IUPAC name is 2-[4-[[4-(2-acetyloxyethoxy)-3,5-dimethylphenyl]methyl]-2,6-dimethylphenoxy]ethyl acetate.
| Compound Name | 2-[4-[[4-(2-acetyloxyethoxy)-3,5-dimethylphenyl]methyl]-2,6-dimethylphenoxy]ethyl acetate |
|---|---|
| PubChem CID | 126731074 |
| Molecular Formula | C25H32O6 |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.22 |
| IUPAC Name | 2-[4-[[4-(2-acetyloxyethoxy)-3,5-dimethylphenyl]methyl]-2,6-dimethylphenoxy]ethyl acetate |
| SMILES | CC(=O)OCCOc1c(C)cc(Cc2cc(C)c(OCCOC(C)=O)c(C)c2)cc1C |
| InChI | InChI=1S/C25H32O6/c1-16-11-22(12-17(2)24(16)30-9-7-28-20(5)26)15-23-13-18(3)25(19(4)14-23)31-10-8-29-21(6)27/h11-14H,7-10,15H2,1-6H3 |
| InChIKey | PZNZRUGEWBUUAG-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|