C41H52N4O6 — CID 102051802
2-[(5,11,17,23-tetraamino-26,27,28-tripropoxy-25-pentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3,5,7(28),9,11,13(27),15(26),16,18,21(25),22-dodecaenyl)oxy]ethyl acetate (PubChem CID 102051802) has the molecular formula C41H52N4O6 and a molecular weight of 696.89 g/mol. Its IUPAC name is 2-[(5,11,17,23-tetraamino-26,27,28-tripropoxy-25-pentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3,5,7(28),9,11,13(27),15(26),16,18,21(25),22-dodecaenyl)oxy]ethyl acetate.
| Compound Name | 2-[(5,11,17,23-tetraamino-26,27,28-tripropoxy-25-pentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3,5,7(28),9,11,13(27),15(26),16,18,21(25),22-dodecaenyl)oxy]ethyl acetate |
|---|---|
| PubChem CID | 102051802 |
| Molecular Formula | C41H52N4O6 |
| Molecular Weight | 696.89 g/mol |
| Exact Mass | 696.39 |
| IUPAC Name | 2-[(5,11,17,23-tetraamino-26,27,28-tripropoxy-25-pentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3,5,7(28),9,11,13(27),15(26),16,18,21(25),22-dodecaenyl)oxy]ethyl acetate |
| SMILES | CCCOc1c2cc(N)cc1Cc1cc(N)cc(c1OCCC)Cc1cc(N)cc(c1OCCOC(C)=O)Cc1cc(N)cc(c1OCCC)C2 |
| InChI | InChI=1S/C41H52N4O6/c1-5-8-48-38-26-13-28-19-35(43)21-30(39(28)49-9-6-2)15-32-23-37(45)24-33(41(32)51-12-11-47-25(4)46)16-31-22-36(44)20-29(40(31)50-10-7-3)14-27(38)18-34(42)17-26/h17-24H,5-16,42-45H2,1-4H3 |
| InChIKey | ARYDXWZFBPDSJB-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 167.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.89 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|