C53H76N4O6 — CID 10605629
tert-butyl N-(11,17,23-triamino-25,26,27,28-tetrapentoxy-5-pentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3,5,7(28),9,11,13(27),15(26),16,18,21(25),22-dodecaenyl)carbamate (PubChem CID 10605629) has the molecular formula C53H76N4O6 and a molecular weight of 865.21 g/mol. Its IUPAC name is tert-butyl N-(11,17,23-triamino-25,26,27,28-tetrapentoxy-5-pentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3,5,7(28),9,11,13(27),15(26),16,18,21(25),22-dodecaenyl)carbamate.
| Compound Name | tert-butyl N-(11,17,23-triamino-25,26,27,28-tetrapentoxy-5-pentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3,5,7(28),9,11,13(27),15(26),16,18,21(25),22-dodecaenyl)carbamate |
|---|---|
| PubChem CID | 10605629 |
| Molecular Formula | C53H76N4O6 |
| Molecular Weight | 865.21 g/mol |
| Exact Mass | 864.58 |
| IUPAC Name | tert-butyl N-(11,17,23-triamino-25,26,27,28-tetrapentoxy-5-pentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3,5,7(28),9,11,13(27),15(26),16,18,21(25),22-dodecaenyl)carbamate |
| SMILES | CCCCCOc1c2cc(N)cc1Cc1cc(N)cc(c1OCCCCC)Cc1cc(NC(=O)OC(C)(C)C)cc(c1OCCCCC)Cc1cc(N)cc(c1OCCCCC)C2 |
| InChI | InChI=1S/C53H76N4O6/c1-8-12-16-20-59-48-36-24-38-30-45(55)32-40(49(38)60-21-17-13-9-2)26-42-34-47(57-52(58)63-53(5,6)7)35-43(51(42)62-23-19-15-11-4)27-41-33-46(56)31-39(25-37(48)29-44(54)28-36)50(41)61-22-18-14-10-3/h28-35H,8-27,54-56H2,1-7H3,(H,57,58) |
| InChIKey | WZVDNHFUCDYWMR-UHFFFAOYSA-N |
| XLogP | 12.73 |
| TPSA | 153.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 865.21 |
| LogP ≤ 5 | 12.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|