C44H60N4O4 — CID 24814575
25-methoxy-26,27,28-tripentoxypentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3(28),4,6,9,11,13(27),15,17,19(26),21(25),22-dodecaene-5,11,17,23-tetramine (PubChem CID 24814575) has the molecular formula C44H60N4O4 and a molecular weight of 708.99 g/mol. Its IUPAC name is 25-methoxy-26,27,28-tripentoxypentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3(28),4,6,9,11,13(27),15,17,19(26),21(25),22-dodecaene-5,11,17,23-tetramine.
| Compound Name | 25-methoxy-26,27,28-tripentoxypentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3(28),4,6,9,11,13(27),15,17,19(26),21(25),22-dodecaene-5,11,17,23-tetramine |
|---|---|
| PubChem CID | 24814575 |
| Molecular Formula | C44H60N4O4 |
| Molecular Weight | 708.99 g/mol |
| Exact Mass | 708.46 |
| IUPAC Name | 25-methoxy-26,27,28-tripentoxypentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3(28),4,6,9,11,13(27),15,17,19(26),21(25),22-dodecaene-5,11,17,23-tetramine |
| SMILES | CCCCCOc1c2cc(N)cc1Cc1cc(N)cc(c1OCCCCC)Cc1cc(N)cc(c1OCCCCC)Cc1cc(N)cc(c1OC)C2 |
| InChI | InChI=1S/C44H60N4O4/c1-5-8-11-14-50-42-31-17-29-21-37(45)22-30(41(29)49-4)18-32-24-39(47)26-34(43(32)51-15-12-9-6-2)20-36-28-40(48)27-35(19-33(42)25-38(46)23-31)44(36)52-16-13-10-7-3/h21-28H,5-20,45-48H2,1-4H3 |
| InChIKey | SVNHROPJYKJBLM-UHFFFAOYSA-N |
| XLogP | 9.41 |
| TPSA | 141.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.99 |
| LogP ≤ 5 | 9.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|