C40H54N4O4 — CID 153419096
25,26,27,28-tetrapropoxypentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3,5,7(28),9,11,13(27),15(26),16,18,22-undecaene-5,11,17,23-tetramine (PubChem CID 153419096) has the molecular formula C40H54N4O4 and a molecular weight of 654.90 g/mol. Its IUPAC name is 25,26,27,28-tetrapropoxypentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3,5,7(28),9,11,13(27),15(26),16,18,22-undecaene-5,11,17,23-tetramine.
| Compound Name | 25,26,27,28-tetrapropoxypentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3,5,7(28),9,11,13(27),15(26),16,18,22-undecaene-5,11,17,23-tetramine |
|---|---|
| PubChem CID | 153419096 |
| Molecular Formula | C40H54N4O4 |
| Molecular Weight | 654.90 g/mol |
| Exact Mass | 654.41 |
| IUPAC Name | 25,26,27,28-tetrapropoxypentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3,5,7(28),9,11,13(27),15(26),16,18,22-undecaene-5,11,17,23-tetramine |
| SMILES | CCCOc1c2cc(N)cc1Cc1cc(N)cc(c1OCCC)Cc1cc(N)cc(c1OCCC)CC1C=C(N)C=C(C2)C1OCCC |
| InChI | InChI=1S/C40H54N4O4/c1-5-9-45-37-25-13-27-19-34(42)21-29(38(27)46-10-6-2)15-31-23-36(44)24-32(40(31)48-12-8-4)16-30-22-35(43)20-28(39(30)47-11-7-3)14-26(37)18-33(41)17-25/h17-25,37H,5-16,41-44H2,1-4H3 |
| InChIKey | FFBNAVIVNNAXSA-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 141.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.90 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|