C44H44F4O8 — CID 102254254
25,26,27,28-tetrapropoxypentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3,5,7(28),9,11,13(27),15(26),16,18,21(25),22-dodecaene-5,11,17,23-tetracarbonyl fluoride (PubChem CID 102254254) has the molecular formula C44H44F4O8 and a molecular weight of 776.82 g/mol. Its IUPAC name is 25,26,27,28-tetrapropoxypentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3,5,7(28),9,11,13(27),15(26),16,18,21(25),22-dodecaene-5,11,17,23-tetracarbonyl fluoride.
| Compound Name | 25,26,27,28-tetrapropoxypentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3,5,7(28),9,11,13(27),15(26),16,18,21(25),22-dodecaene-5,11,17,23-tetracarbonyl fluoride |
|---|---|
| PubChem CID | 102254254 |
| Molecular Formula | C44H44F4O8 |
| Molecular Weight | 776.82 g/mol |
| Exact Mass | 776.30 |
| IUPAC Name | 25,26,27,28-tetrapropoxypentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3,5,7(28),9,11,13(27),15(26),16,18,21(25),22-dodecaene-5,11,17,23-tetracarbonyl fluoride |
| SMILES | CCCOc1c2cc(C(=O)F)cc1Cc1cc(C(=O)F)cc(c1OCCC)Cc1cc(C(=O)F)cc(c1OCCC)Cc1cc(C(=O)F)cc(c1OCCC)C2 |
| InChI | InChI=1S/C44H44F4O8/c1-5-9-53-37-25-13-27-19-34(42(46)50)21-29(38(27)54-10-6-2)15-31-23-36(44(48)52)24-32(40(31)56-12-8-4)16-30-22-35(43(47)51)20-28(39(30)55-11-7-3)14-26(37)18-33(17-25)41(45)49/h17-24H,5-16H2,1-4H3 |
| InChIKey | LZFWAONCNWHHSX-UHFFFAOYSA-N |
| XLogP | 9.96 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 776.82 |
| LogP ≤ 5 | 9.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|