C22H28O7 — CID 142654793
2-[4-[(2,3,4,5-tetramethoxy-6-methylphenyl)methyl]phenoxy]ethyl acetate (PubChem CID 142654793) has the molecular formula C22H28O7 and a molecular weight of 404.46 g/mol. Its IUPAC name is 2-[4-[(2,3,4,5-tetramethoxy-6-methylphenyl)methyl]phenoxy]ethyl acetate.
| Compound Name | 2-[4-[(2,3,4,5-tetramethoxy-6-methylphenyl)methyl]phenoxy]ethyl acetate |
|---|---|
| PubChem CID | 142654793 |
| Molecular Formula | C22H28O7 |
| Molecular Weight | 404.46 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | 2-[4-[(2,3,4,5-tetramethoxy-6-methylphenyl)methyl]phenoxy]ethyl acetate |
| SMILES | COc1c(C)c(Cc2ccc(OCCOC(C)=O)cc2)c(OC)c(OC)c1OC |
| InChI | InChI=1S/C22H28O7/c1-14-18(20(25-4)22(27-6)21(26-5)19(14)24-3)13-16-7-9-17(10-8-16)29-12-11-28-15(2)23/h7-10H,11-13H2,1-6H3 |
| InChIKey | AFYMQNOSCMXPJN-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.46 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|