C26H38N2O4 — CID 146665945
(2S)-2-amino-3-[4-[3-(2,5-dimethoxy-3,4,6-trimethylphenyl)propoxy]phenyl]-N-propan-2-ylpropanamide (PubChem CID 146665945) has the molecular formula C26H38N2O4 and a molecular weight of 442.60 g/mol. Its IUPAC name is (2S)-2-amino-3-[4-[3-(2,5-dimethoxy-3,4,6-trimethylphenyl)propoxy]phenyl]-N-propan-2-ylpropanamide.
| Compound Name | (2S)-2-amino-3-[4-[3-(2,5-dimethoxy-3,4,6-trimethylphenyl)propoxy]phenyl]-N-propan-2-ylpropanamide |
|---|---|
| PubChem CID | 146665945 |
| Molecular Formula | C26H38N2O4 |
| Molecular Weight | 442.60 g/mol |
| Exact Mass | 442.28 |
| IUPAC Name | (2S)-2-amino-3-[4-[3-(2,5-dimethoxy-3,4,6-trimethylphenyl)propoxy]phenyl]-N-propan-2-ylpropanamide |
| SMILES | COc1c(C)c(C)c(OC)c(CCCOc2ccc(C[C@H](N)C(=O)NC(C)C)cc2)c1C |
| InChI | InChI=1S/C26H38N2O4/c1-16(2)28-26(29)23(27)15-20-10-12-21(13-11-20)32-14-8-9-22-19(5)24(30-6)17(3)18(4)25(22)31-7/h10-13,16,23H,8-9,14-15,27H2,1-7H3,(H,28,29)/t23-/m0/s1 |
| InChIKey | PJJBYLZWKKDXHL-QHCPKHFHSA-N |
| XLogP | 4.04 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.60 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|