C26H33NO5S — CID 174277687
2-[5-[[4-[3-(2,5-dimethoxy-3,4,6-trimethylphenyl)propoxy]phenyl]methyl]-1,3-thiazolidin-4-yl]-2-oxoacetaldehyde (PubChem CID 174277687) has the molecular formula C26H33NO5S and a molecular weight of 471.62 g/mol. Its IUPAC name is 2-[5-[[4-[3-(2,5-dimethoxy-3,4,6-trimethylphenyl)propoxy]phenyl]methyl]-1,3-thiazolidin-4-yl]-2-oxoacetaldehyde.
| Compound Name | 2-[5-[[4-[3-(2,5-dimethoxy-3,4,6-trimethylphenyl)propoxy]phenyl]methyl]-1,3-thiazolidin-4-yl]-2-oxoacetaldehyde |
|---|---|
| PubChem CID | 174277687 |
| Molecular Formula | C26H33NO5S |
| Molecular Weight | 471.62 g/mol |
| Exact Mass | 471.21 |
| IUPAC Name | 2-[5-[[4-[3-(2,5-dimethoxy-3,4,6-trimethylphenyl)propoxy]phenyl]methyl]-1,3-thiazolidin-4-yl]-2-oxoacetaldehyde |
| SMILES | COc1c(C)c(C)c(OC)c(CCCOc2ccc(CC3SCNC3C(=O)C=O)cc2)c1C |
| InChI | InChI=1S/C26H33NO5S/c1-16-17(2)26(31-5)21(18(3)25(16)30-4)7-6-12-32-20-10-8-19(9-11-20)13-23-24(22(29)14-28)27-15-33-23/h8-11,14,23-24,27H,6-7,12-13,15H2,1-5H3 |
| InChIKey | WFGGEQQASRBLEZ-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.62 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|