C15H17NO4S — CID 174306909
3-[4-[(4-oxaldehydoyl-1,3-thiazolidin-5-yl)methyl]phenoxy]propanal (PubChem CID 174306909) has the molecular formula C15H17NO4S and a molecular weight of 307.37 g/mol. Its IUPAC name is 3-[4-[(4-oxaldehydoyl-1,3-thiazolidin-5-yl)methyl]phenoxy]propanal.
| Compound Name | 3-[4-[(4-oxaldehydoyl-1,3-thiazolidin-5-yl)methyl]phenoxy]propanal |
|---|---|
| PubChem CID | 174306909 |
| Molecular Formula | C15H17NO4S |
| Molecular Weight | 307.37 g/mol |
| Exact Mass | 307.09 |
| IUPAC Name | 3-[4-[(4-oxaldehydoyl-1,3-thiazolidin-5-yl)methyl]phenoxy]propanal |
| SMILES | O=CCCOc1ccc(CC2SCNC2C(=O)C=O)cc1 |
| InChI | InChI=1S/C15H17NO4S/c17-6-1-7-20-12-4-2-11(3-5-12)8-14-15(13(19)9-18)16-10-21-14/h2-6,9,14-16H,1,7-8,10H2 |
| InChIKey | PVSPHGBDERDXRS-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.37 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|