C35H52N2O4 — CID 162429953
ethane;3-[2-[4-(4-methylpent-3-enoxy)phenyl]ethyl]-6-[[4-(4-methylpent-3-enoxy)phenyl]methyl]piperazine-2,5-dione (PubChem CID 162429953) has the molecular formula C35H52N2O4 and a molecular weight of 564.81 g/mol. Its IUPAC name is ethane;3-[2-[4-(4-methylpent-3-enoxy)phenyl]ethyl]-6-[[4-(4-methylpent-3-enoxy)phenyl]methyl]piperazine-2,5-dione.
| Compound Name | ethane;3-[2-[4-(4-methylpent-3-enoxy)phenyl]ethyl]-6-[[4-(4-methylpent-3-enoxy)phenyl]methyl]piperazine-2,5-dione |
|---|---|
| PubChem CID | 162429953 |
| Molecular Formula | C35H52N2O4 |
| Molecular Weight | 564.81 g/mol |
| Exact Mass | 564.39 |
| IUPAC Name | ethane;3-[2-[4-(4-methylpent-3-enoxy)phenyl]ethyl]-6-[[4-(4-methylpent-3-enoxy)phenyl]methyl]piperazine-2,5-dione |
| SMILES | CC.CC.CC(C)=CCCOc1ccc(CCC2NC(=O)C(Cc3ccc(OCCC=C(C)C)cc3)NC2=O)cc1 |
| InChI | InChI=1S/C31H40N2O4.2C2H6/c1-22(2)7-5-19-36-26-14-9-24(10-15-26)13-18-28-30(34)33-29(31(35)32-28)21-25-11-16-27(17-12-25)37-20-6-8-23(3)4;2*1-2/h7-12,14-17,28-29H,5-6,13,18-21H2,1-4H3,(H,32,35)(H,33,34);2*1-2H3 |
| InChIKey | DWOMLUYYWUJFQX-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.81 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|