C27H32N2O3 — CID 170070503
3-[[4-(2-cyclopropylethyl)phenyl]methyl]-6-[[4-[2-(oxiran-2-yl)ethyl]phenyl]methyl]piperazine-2,5-dione (PubChem CID 170070503) has the molecular formula C27H32N2O3 and a molecular weight of 432.56 g/mol. Its IUPAC name is 3-[[4-(2-cyclopropylethyl)phenyl]methyl]-6-[[4-[2-(oxiran-2-yl)ethyl]phenyl]methyl]piperazine-2,5-dione.
| Compound Name | 3-[[4-(2-cyclopropylethyl)phenyl]methyl]-6-[[4-[2-(oxiran-2-yl)ethyl]phenyl]methyl]piperazine-2,5-dione |
|---|---|
| PubChem CID | 170070503 |
| Molecular Formula | C27H32N2O3 |
| Molecular Weight | 432.56 g/mol |
| Exact Mass | 432.24 |
| IUPAC Name | 3-[[4-(2-cyclopropylethyl)phenyl]methyl]-6-[[4-[2-(oxiran-2-yl)ethyl]phenyl]methyl]piperazine-2,5-dione |
| SMILES | O=C1NC(Cc2ccc(CCC3CO3)cc2)C(=O)NC1Cc1ccc(CCC2CC2)cc1 |
| InChI | InChI=1S/C27H32N2O3/c30-26-24(15-21-9-5-19(6-10-21)4-3-18-1-2-18)28-27(31)25(29-26)16-22-11-7-20(8-12-22)13-14-23-17-32-23/h5-12,18,23-25H,1-4,13-17H2,(H,28,31)(H,29,30) |
| InChIKey | NYPVVHNMKFMQAG-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 70.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.56 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|