C14H17NO4S — CID 22961925
5-[2-[4-(2-methoxyethyl)phenoxy]ethyl]-1,3-thiazolidine-2,4-dione (PubChem CID 22961925) has the molecular formula C14H17NO4S and a molecular weight of 295.36 g/mol. Its IUPAC name is 5-[2-[4-(2-methoxyethyl)phenoxy]ethyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[2-[4-(2-methoxyethyl)phenoxy]ethyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 22961925 |
| Molecular Formula | C14H17NO4S |
| Molecular Weight | 295.36 g/mol |
| Exact Mass | 295.09 |
| IUPAC Name | 5-[2-[4-(2-methoxyethyl)phenoxy]ethyl]-1,3-thiazolidine-2,4-dione |
| SMILES | COCCc1ccc(OCCC2SC(=O)NC2=O)cc1 |
| InChI | InChI=1S/C14H17NO4S/c1-18-8-6-10-2-4-11(5-3-10)19-9-7-12-13(16)15-14(17)20-12/h2-5,12H,6-9H2,1H3,(H,15,16,17) |
| InChIKey | CIDCFCMXAOIGBJ-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.36 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|