C19H21NO4S — CID 130308018
5-[[4-[2-(4-methoxyphenyl)ethoxy]cyclohexa-1,3-dien-1-yl]methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 130308018) has the molecular formula C19H21NO4S and a molecular weight of 359.45 g/mol. Its IUPAC name is 5-[[4-[2-(4-methoxyphenyl)ethoxy]cyclohexa-1,3-dien-1-yl]methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[4-[2-(4-methoxyphenyl)ethoxy]cyclohexa-1,3-dien-1-yl]methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 130308018 |
| Molecular Formula | C19H21NO4S |
| Molecular Weight | 359.45 g/mol |
| Exact Mass | 359.12 |
| IUPAC Name | 5-[[4-[2-(4-methoxyphenyl)ethoxy]cyclohexa-1,3-dien-1-yl]methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | COc1ccc(CCOC2=CC=C(CC3SC(=O)NC3=O)CC2)cc1 |
| InChI | InChI=1S/C19H21NO4S/c1-23-15-6-2-13(3-7-15)10-11-24-16-8-4-14(5-9-16)12-17-18(21)20-19(22)25-17/h2-4,6-8,17H,5,9-12H2,1H3,(H,20,21,22) |
| InChIKey | FSNAEUCNYDUXDG-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.45 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|