C9H13NO5S — CID 139831688
2-methoxyethyl 3-(2,4-dioxo-1,3-thiazolidin-5-yl)propanoate (PubChem CID 139831688) has the molecular formula C9H13NO5S and a molecular weight of 247.27 g/mol. Its IUPAC name is 2-methoxyethyl 3-(2,4-dioxo-1,3-thiazolidin-5-yl)propanoate.
| Compound Name | 2-methoxyethyl 3-(2,4-dioxo-1,3-thiazolidin-5-yl)propanoate |
|---|---|
| PubChem CID | 139831688 |
| Molecular Formula | C9H13NO5S |
| Molecular Weight | 247.27 g/mol |
| Exact Mass | 247.05 |
| IUPAC Name | 2-methoxyethyl 3-(2,4-dioxo-1,3-thiazolidin-5-yl)propanoate |
| SMILES | COCCOC(=O)CCC1SC(=O)NC1=O |
| InChI | InChI=1S/C9H13NO5S/c1-14-4-5-15-7(11)3-2-6-8(12)10-9(13)16-6/h6H,2-5H2,1H3,(H,10,12,13) |
| InChIKey | JXLNIDBPAOSMQA-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.27 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|