C29H33NO8S — CID 19822219
2-methoxyethyl 2-[2-[[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenoxy]methyl]-2,5,7,8-tetramethylchromen-6-yl]oxyacetate (PubChem CID 19822219) has the molecular formula C29H33NO8S and a molecular weight of 555.65 g/mol. Its IUPAC name is 2-methoxyethyl 2-[2-[[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenoxy]methyl]-2,5,7,8-tetramethylchromen-6-yl]oxyacetate.
| Compound Name | 2-methoxyethyl 2-[2-[[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenoxy]methyl]-2,5,7,8-tetramethylchromen-6-yl]oxyacetate |
|---|---|
| PubChem CID | 19822219 |
| Molecular Formula | C29H33NO8S |
| Molecular Weight | 555.65 g/mol |
| Exact Mass | 555.19 |
| IUPAC Name | 2-methoxyethyl 2-[2-[[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenoxy]methyl]-2,5,7,8-tetramethylchromen-6-yl]oxyacetate |
| SMILES | COCCOC(=O)COc1c(C)c(C)c2c(c1C)C=CC(C)(COc1ccc(CC3SC(=O)NC3=O)cc1)O2 |
| InChI | InChI=1S/C29H33NO8S/c1-17-18(2)26-22(19(3)25(17)36-15-24(31)35-13-12-34-5)10-11-29(4,38-26)16-37-21-8-6-20(7-9-21)14-23-27(32)30-28(33)39-23/h6-11,23H,12-16H2,1-5H3,(H,30,32,33) |
| InChIKey | ZJKBTAZOXXTOCX-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 109.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.65 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|