C30H36N2O7S — CID 139636554
5-[[4-[[2,5,7,8-tetramethyl-6-(2-morpholin-4-yl-2-oxoethoxy)-3,4-dihydrochromen-2-yl]methoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 139636554) has the molecular formula C30H36N2O7S and a molecular weight of 568.69 g/mol. Its IUPAC name is 5-[[4-[[2,5,7,8-tetramethyl-6-(2-morpholin-4-yl-2-oxoethoxy)-3,4-dihydrochromen-2-yl]methoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[4-[[2,5,7,8-tetramethyl-6-(2-morpholin-4-yl-2-oxoethoxy)-3,4-dihydrochromen-2-yl]methoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 139636554 |
| Molecular Formula | C30H36N2O7S |
| Molecular Weight | 568.69 g/mol |
| Exact Mass | 568.22 |
| IUPAC Name | 5-[[4-[[2,5,7,8-tetramethyl-6-(2-morpholin-4-yl-2-oxoethoxy)-3,4-dihydrochromen-2-yl]methoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | Cc1c(C)c2c(c(C)c1OCC(=O)N1CCOCC1)CCC(C)(COc1ccc(CC3SC(=O)NC3=O)cc1)O2 |
| InChI | InChI=1S/C30H36N2O7S/c1-18-19(2)27-23(20(3)26(18)37-16-25(33)32-11-13-36-14-12-32)9-10-30(4,39-27)17-38-22-7-5-21(6-8-22)15-24-28(34)31-29(35)40-24/h5-8,24H,9-17H2,1-4H3,(H,31,34,35) |
| InChIKey | OTYXQLGTNFGXKG-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 103.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.69 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|