C33H34N2O7S — CID 152774341
[2-[[4-[(2-imino-4-oxo-1,3-thiazolidin-5-yl)methyl]phenoxy]methyl]-7,8-dimethoxy-2,5-dimethyl-3,4-dihydrochromen-6-yl] 3-phenylprop-2-enoate (PubChem CID 152774341) has the molecular formula C33H34N2O7S and a molecular weight of 602.71 g/mol. Its IUPAC name is [2-[[4-[(2-imino-4-oxo-1,3-thiazolidin-5-yl)methyl]phenoxy]methyl]-7,8-dimethoxy-2,5-dimethyl-3,4-dihydrochromen-6-yl] 3-phenylprop-2-enoate.
| Compound Name | [2-[[4-[(2-imino-4-oxo-1,3-thiazolidin-5-yl)methyl]phenoxy]methyl]-7,8-dimethoxy-2,5-dimethyl-3,4-dihydrochromen-6-yl] 3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 152774341 |
| Molecular Formula | C33H34N2O7S |
| Molecular Weight | 602.71 g/mol |
| Exact Mass | 602.21 |
| IUPAC Name | [2-[[4-[(2-imino-4-oxo-1,3-thiazolidin-5-yl)methyl]phenoxy]methyl]-7,8-dimethoxy-2,5-dimethyl-3,4-dihydrochromen-6-yl] 3-phenylprop-2-enoate |
| SMILES | [H]/N=C1\NC(=O)C(Cc2ccc(OCC3(C)CCc4c(C)c(OC(=O)C=Cc5ccccc5)c(OC)c(OC)c4O3)cc2)S1 |
| InChI | InChI=1S/C33H34N2O7S/c1-20-24-16-17-33(2,19-40-23-13-10-22(11-14-23)18-25-31(37)35-32(34)43-25)42-28(24)30(39-4)29(38-3)27(20)41-26(36)15-12-21-8-6-5-7-9-21/h5-15,25H,16-19H2,1-4H3,(H2,34,35,37) |
| InChIKey | LWXFFYBAPHOPNS-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 116.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.71 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|