C31H38N2O6S — CID 139636551
5-[[4-[[2,5,7,8-tetramethyl-6-(2-oxo-2-piperidin-1-ylethoxy)-3,4-dihydrochromen-2-yl]methoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 139636551) has the molecular formula C31H38N2O6S and a molecular weight of 566.72 g/mol. Its IUPAC name is 5-[[4-[[2,5,7,8-tetramethyl-6-(2-oxo-2-piperidin-1-ylethoxy)-3,4-dihydrochromen-2-yl]methoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[4-[[2,5,7,8-tetramethyl-6-(2-oxo-2-piperidin-1-ylethoxy)-3,4-dihydrochromen-2-yl]methoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 139636551 |
| Molecular Formula | C31H38N2O6S |
| Molecular Weight | 566.72 g/mol |
| Exact Mass | 566.25 |
| IUPAC Name | 5-[[4-[[2,5,7,8-tetramethyl-6-(2-oxo-2-piperidin-1-ylethoxy)-3,4-dihydrochromen-2-yl]methoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | Cc1c(C)c2c(c(C)c1OCC(=O)N1CCCCC1)CCC(C)(COc1ccc(CC3SC(=O)NC3=O)cc1)O2 |
| InChI | InChI=1S/C31H38N2O6S/c1-19-20(2)28-24(21(3)27(19)37-17-26(34)33-14-6-5-7-15-33)12-13-31(4,39-28)18-38-23-10-8-22(9-11-23)16-25-29(35)32-30(36)40-25/h8-11,25H,5-7,12-18H2,1-4H3,(H,32,35,36) |
| InChIKey | UIEOXOFGTRXXFL-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.72 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|