C21H30N2O5S — CID 101228565
5-[[4-[2-[(3S,4R)-3,4-diethoxy-1-methylpyrrolidin-2-yl]ethoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 101228565) has the molecular formula C21H30N2O5S and a molecular weight of 422.55 g/mol. Its IUPAC name is 5-[[4-[2-[(3S,4R)-3,4-diethoxy-1-methylpyrrolidin-2-yl]ethoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[4-[2-[(3S,4R)-3,4-diethoxy-1-methylpyrrolidin-2-yl]ethoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 101228565 |
| Molecular Formula | C21H30N2O5S |
| Molecular Weight | 422.55 g/mol |
| Exact Mass | 422.19 |
| IUPAC Name | 5-[[4-[2-[(3S,4R)-3,4-diethoxy-1-methylpyrrolidin-2-yl]ethoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | CCO[C@@H]1CN(C)C(CCOc2ccc(CC3SC(=O)NC3=O)cc2)[C@@H]1OCC |
| InChI | InChI=1S/C21H30N2O5S/c1-4-26-17-13-23(3)16(19(17)27-5-2)10-11-28-15-8-6-14(7-9-15)12-18-20(24)22-21(25)29-18/h6-9,16-19H,4-5,10-13H2,1-3H3,(H,22,24,25)/t16?,17-,18?,19+/m1/s1 |
| InChIKey | QQOIHNKPCLSURR-CHPDAQJUSA-N |
| XLogP | 2.47 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.55 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|