4-[2-(2,4-dioxo-1,3-thiazolidin-5-yl)ethoxy]benzoic acid

C12H11NO5S — CID 22961921

IUPAC4-[2-(2,4-dioxo-1,3-thiazolidin-5-yl)ethoxy]benzoic acid
SMILESO=C1NC(=O)C(CCOc2ccc(C(=O)O)cc2)S1
InChIInChI=1S/C12H11NO5S/c14-10-9(19-12(17)13-10)5-6-18-8-3-1-7(2-4-8)11(15)16/h1-4,9H,5-6H2,(H,15,16)(H,13,14,17)
InChIKeyNINMLYIZNJHKTL-UHFFFAOYSA-N
MW281.29 g/mol
LogP1.51
Rot. Bonds5

About 4-[2-(2,4-dioxo-1,3-thiazolidin-5-yl)ethoxy]benzoic acid

4-[2-(2,4-dioxo-1,3-thiazolidin-5-yl)ethoxy]benzoic acid (PubChem CID 22961921) has the molecular formula C12H11NO5S and a molecular weight of 281.29 g/mol. Its IUPAC name is 4-[2-(2,4-dioxo-1,3-thiazolidin-5-yl)ethoxy]benzoic acid.

Molecular Properties

Compound Name4-[2-(2,4-dioxo-1,3-thiazolidin-5-yl)ethoxy]benzoic acid
PubChem CID22961921
Molecular FormulaC12H11NO5S
Molecular Weight281.29 g/mol
Exact Mass281.04
IUPAC Name4-[2-(2,4-dioxo-1,3-thiazolidin-5-yl)ethoxy]benzoic acid
SMILESO=C1NC(=O)C(CCOc2ccc(C(=O)O)cc2)S1
InChIInChI=1S/C12H11NO5S/c14-10-9(19-12(17)13-10)5-6-18-8-3-1-7(2-4-8)11(15)16/h1-4,9H,5-6H2,(H,15,16)(H,13,14,17)
InChIKeyNINMLYIZNJHKTL-UHFFFAOYSA-N
XLogP1.51
TPSA92.70 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500281.29
LogP ≤ 51.51
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'thioester', 'substructure': 'N/A'}

Analyze 4-[2-(2,4-dioxo-1,3-thiazolidin-5-yl)ethoxy]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-[2-(2,4-dioxo-1,3-thiazolidin-5-yl)ethoxy]benzoic acid?
The IUPAC name of 4-[2-(2,4-dioxo-1,3-thiazolidin-5-yl)ethoxy]benzoic acid (CID 22961921) is 4-[2-(2,4-dioxo-1,3-thiazolidin-5-yl)ethoxy]benzoic acid.
What is the SMILES notation for 4-[2-(2,4-dioxo-1,3-thiazolidin-5-yl)ethoxy]benzoic acid?
The canonical SMILES for 4-[2-(2,4-dioxo-1,3-thiazolidin-5-yl)ethoxy]benzoic acid is O=C1NC(=O)C(CCOc2ccc(C(=O)O)cc2)S1.
What is the InChIKey of 4-[2-(2,4-dioxo-1,3-thiazolidin-5-yl)ethoxy]benzoic acid?
The InChIKey is NINMLYIZNJHKTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11NO5S/c14-10-9(19-12(17)13-10)5-6-18-8-3-1-7(2-4-8)11(15)16/h1-4,9H,5-6H2,(H,15,16)(H,13,14,17).
What are the key properties of 4-[2-(2,4-dioxo-1,3-thiazolidin-5-yl)ethoxy]benzoic acid?
4-[2-(2,4-dioxo-1,3-thiazolidin-5-yl)ethoxy]benzoic acid has a molecular weight of 281.29 g/mol, XLogP of 1.51, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(2,4-dioxo-1,3-thiazolidin-5-yl)ethoxy]benzoic acid is sourced from PubChem (CID 22961921), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).