C12H11NO5S — CID 22961921
4-[2-(2,4-dioxo-1,3-thiazolidin-5-yl)ethoxy]benzoic acid (PubChem CID 22961921) has the molecular formula C12H11NO5S and a molecular weight of 281.29 g/mol. Its IUPAC name is 4-[2-(2,4-dioxo-1,3-thiazolidin-5-yl)ethoxy]benzoic acid.
| Compound Name | 4-[2-(2,4-dioxo-1,3-thiazolidin-5-yl)ethoxy]benzoic acid |
|---|---|
| PubChem CID | 22961921 |
| Molecular Formula | C12H11NO5S |
| Molecular Weight | 281.29 g/mol |
| Exact Mass | 281.04 |
| IUPAC Name | 4-[2-(2,4-dioxo-1,3-thiazolidin-5-yl)ethoxy]benzoic acid |
| SMILES | O=C1NC(=O)C(CCOc2ccc(C(=O)O)cc2)S1 |
| InChI | InChI=1S/C12H11NO5S/c14-10-9(19-12(17)13-10)5-6-18-8-3-1-7(2-4-8)11(15)16/h1-4,9H,5-6H2,(H,15,16)(H,13,14,17) |
| InChIKey | NINMLYIZNJHKTL-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.29 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|