C18H16N2O5S2 — CID 159734691
5-(2-naphthalen-2-yloxyethyl)-1,3-thiazolidine-2,4-dione;1,3-thiazolidine-2,4-dione (PubChem CID 159734691) has the molecular formula C18H16N2O5S2 and a molecular weight of 404.47 g/mol. Its IUPAC name is 5-(2-naphthalen-2-yloxyethyl)-1,3-thiazolidine-2,4-dione;1,3-thiazolidine-2,4-dione.
| Compound Name | 5-(2-naphthalen-2-yloxyethyl)-1,3-thiazolidine-2,4-dione;1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 159734691 |
| Molecular Formula | C18H16N2O5S2 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.05 |
| IUPAC Name | 5-(2-naphthalen-2-yloxyethyl)-1,3-thiazolidine-2,4-dione;1,3-thiazolidine-2,4-dione |
| SMILES | O=C1CSC(=O)N1.O=C1NC(=O)C(CCOc2ccc3ccccc3c2)S1 |
| InChI | InChI=1S/C15H13NO3S.C3H3NO2S/c17-14-13(20-15(18)16-14)7-8-19-12-6-5-10-3-1-2-4-11(10)9-12;5-2-1-7-3(6)4-2/h1-6,9,13H,7-8H2,(H,16,17,18);1H2,(H,4,5,6) |
| InChIKey | NBRKVSPEYJUSPH-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|