C35H36O5 — CID 145389660
2-[4-[4-[2,3-dimethoxy-4-(4-propylphenyl)phenyl]phenyl]phenoxy]ethyl 2-methylprop-2-enoate (PubChem CID 145389660) has the molecular formula C35H36O5 and a molecular weight of 536.67 g/mol. Its IUPAC name is 2-[4-[4-[2,3-dimethoxy-4-(4-propylphenyl)phenyl]phenyl]phenoxy]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[4-[4-[2,3-dimethoxy-4-(4-propylphenyl)phenyl]phenyl]phenoxy]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 145389660 |
| Molecular Formula | C35H36O5 |
| Molecular Weight | 536.67 g/mol |
| Exact Mass | 536.26 |
| IUPAC Name | 2-[4-[4-[2,3-dimethoxy-4-(4-propylphenyl)phenyl]phenyl]phenoxy]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCOc1ccc(-c2ccc(-c3ccc(-c4ccc(CCC)cc4)c(OC)c3OC)cc2)cc1 |
| InChI | InChI=1S/C35H36O5/c1-6-7-25-8-10-28(11-9-25)31-20-21-32(34(38-5)33(31)37-4)29-14-12-26(13-15-29)27-16-18-30(19-17-27)39-22-23-40-35(36)24(2)3/h8-21H,2,6-7,22-23H2,1,3-5H3 |
| InChIKey | DAQVUBPQCFSGGF-UHFFFAOYSA-N |
| XLogP | 8.16 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.67 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|