C20H10N4O4S4 — CID 89119328
[4-acetyloxy-2,6-bis(dicyanomethylidene)-[1,3]dithiolo[4,5-f][1,3]benzodithiol-8-yl] 2-methylpropanoate (PubChem CID 89119328) has the molecular formula C20H10N4O4S4 and a molecular weight of 498.59 g/mol. Its IUPAC name is [4-acetyloxy-2,6-bis(dicyanomethylidene)-[1,3]dithiolo[4,5-f][1,3]benzodithiol-8-yl] 2-methylpropanoate.
| Compound Name | [4-acetyloxy-2,6-bis(dicyanomethylidene)-[1,3]dithiolo[4,5-f][1,3]benzodithiol-8-yl] 2-methylpropanoate |
|---|---|
| PubChem CID | 89119328 |
| Molecular Formula | C20H10N4O4S4 |
| Molecular Weight | 498.59 g/mol |
| Exact Mass | 497.96 |
| IUPAC Name | [4-acetyloxy-2,6-bis(dicyanomethylidene)-[1,3]dithiolo[4,5-f][1,3]benzodithiol-8-yl] 2-methylpropanoate |
| SMILES | CC(=O)Oc1c2c(c(OC(=O)C(C)C)c3c1SC(=C(C#N)C#N)S3)SC(=C(C#N)C#N)S2 |
| InChI | InChI=1S/C20H10N4O4S4/c1-8(2)18(26)28-13-16-14(29-19(31-16)10(4-21)5-22)12(27-9(3)25)15-17(13)32-20(30-15)11(6-23)7-24/h8H,1-3H3 |
| InChIKey | CUJUGMBFIGQZGA-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 147.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.59 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'ene_cyano_D(3)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|