C30H38N4O2S4 — CID 88895875
N-[2,6-bis(1-cyanoethylidene)-8-(2-ethylhexanoylamino)-[1,3]dithiolo[4,5-f][1,3]benzodithiol-4-yl]-2-ethylhexanamide (PubChem CID 88895875) has the molecular formula C30H38N4O2S4 and a molecular weight of 614.93 g/mol. Its IUPAC name is N-[2,6-bis(1-cyanoethylidene)-8-(2-ethylhexanoylamino)-[1,3]dithiolo[4,5-f][1,3]benzodithiol-4-yl]-2-ethylhexanamide.
| Compound Name | N-[2,6-bis(1-cyanoethylidene)-8-(2-ethylhexanoylamino)-[1,3]dithiolo[4,5-f][1,3]benzodithiol-4-yl]-2-ethylhexanamide |
|---|---|
| PubChem CID | 88895875 |
| Molecular Formula | C30H38N4O2S4 |
| Molecular Weight | 614.93 g/mol |
| Exact Mass | 614.19 |
| IUPAC Name | N-[2,6-bis(1-cyanoethylidene)-8-(2-ethylhexanoylamino)-[1,3]dithiolo[4,5-f][1,3]benzodithiol-4-yl]-2-ethylhexanamide |
| SMILES | CCCCC(CC)C(=O)Nc1c2c(c(NC(=O)C(CC)CCCC)c3c1SC(=C(C)C#N)S3)SC(=C(C)C#N)S2 |
| InChI | InChI=1S/C30H38N4O2S4/c1-7-11-13-19(9-3)27(35)33-21-23-25(39-29(37-23)17(5)15-31)22(34-28(36)20(10-4)14-12-8-2)26-24(21)38-30(40-26)18(6)16-32/h19-20H,7-14H2,1-6H3,(H,33,35)(H,34,36)/b29-17-,30-18+ |
| InChIKey | BWISBDRYDDQKHW-QCOHSWCKSA-N |
| XLogP | 9.90 |
| TPSA | 105.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.93 |
| LogP ≤ 5 | 9.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'diaminobenzene_3', 'substructure': 'N/A'} |
|---|