C11H20N2OS — CID 40537911
(2S)-N-(4,5-dihydro-1,3-thiazol-2-yl)-2-ethylhexanamide (PubChem CID 40537911) has the molecular formula C11H20N2OS and a molecular weight of 228.36 g/mol. Its IUPAC name is (2S)-N-(4,5-dihydro-1,3-thiazol-2-yl)-2-ethylhexanamide.
| Compound Name | (2S)-N-(4,5-dihydro-1,3-thiazol-2-yl)-2-ethylhexanamide |
|---|---|
| PubChem CID | 40537911 |
| Molecular Formula | C11H20N2OS |
| Molecular Weight | 228.36 g/mol |
| Exact Mass | 228.13 |
| IUPAC Name | (2S)-N-(4,5-dihydro-1,3-thiazol-2-yl)-2-ethylhexanamide |
| SMILES | CCCC[C@H](CC)C(=O)NC1=NCCS1 |
| InChI | InChI=1S/C11H20N2OS/c1-3-5-6-9(4-2)10(14)13-11-12-7-8-15-11/h9H,3-8H2,1-2H3,(H,12,13,14)/t9-/m0/s1 |
| InChIKey | BOJOIVUYTYKROJ-VIFPVBQESA-N |
| XLogP | 2.42 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.36 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |