C25H27NO11S2 — CID 88877192
[(2Z)-7-acetyloxy-2-[1,3-dioxo-1-[3-(3-prop-2-enoyloxypropoxycarbonyloxy)propylamino]propan-2-ylidene]-1,3-benzodithiol-4-yl] propanoate (PubChem CID 88877192) has the molecular formula C25H27NO11S2 and a molecular weight of 581.62 g/mol. Its IUPAC name is [(2Z)-7-acetyloxy-2-[1,3-dioxo-1-[3-(3-prop-2-enoyloxypropoxycarbonyloxy)propylamino]propan-2-ylidene]-1,3-benzodithiol-4-yl] propanoate.
| Compound Name | [(2Z)-7-acetyloxy-2-[1,3-dioxo-1-[3-(3-prop-2-enoyloxypropoxycarbonyloxy)propylamino]propan-2-ylidene]-1,3-benzodithiol-4-yl] propanoate |
|---|---|
| PubChem CID | 88877192 |
| Molecular Formula | C25H27NO11S2 |
| Molecular Weight | 581.62 g/mol |
| Exact Mass | 581.10 |
| IUPAC Name | [(2Z)-7-acetyloxy-2-[1,3-dioxo-1-[3-(3-prop-2-enoyloxypropoxycarbonyloxy)propylamino]propan-2-ylidene]-1,3-benzodithiol-4-yl] propanoate |
| SMILES | C=CC(=O)OCCCOC(=O)OCCCNC(=O)/C(C=O)=C1/Sc2c(OC(C)=O)ccc(OC(=O)CC)c2S1 |
| InChI | InChI=1S/C25H27NO11S2/c1-4-19(29)33-12-7-13-35-25(32)34-11-6-10-26-23(31)16(14-27)24-38-21-17(36-15(3)28)8-9-18(22(21)39-24)37-20(30)5-2/h4,8-9,14H,1,5-7,10-13H2,2-3H3,(H,26,31)/b24-16- |
| InChIKey | GSZIFGZPUMUNHR-JLPGSUDCSA-N |
| XLogP | 3.31 |
| TPSA | 160.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.62 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|