C21H32O2 — CID 19207032
(2-tert-butylphenyl) 4-butylcyclohexane-1-carboxylate (PubChem CID 19207032) has the molecular formula C21H32O2 and a molecular weight of 316.48 g/mol. Its IUPAC name is (2-tert-butylphenyl) 4-butylcyclohexane-1-carboxylate.
| Compound Name | (2-tert-butylphenyl) 4-butylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 19207032 |
| Molecular Formula | C21H32O2 |
| Molecular Weight | 316.48 g/mol |
| Exact Mass | 316.24 |
| IUPAC Name | (2-tert-butylphenyl) 4-butylcyclohexane-1-carboxylate |
| SMILES | CCCCC1CCC(C(=O)Oc2ccccc2C(C)(C)C)CC1 |
| InChI | InChI=1S/C21H32O2/c1-5-6-9-16-12-14-17(15-13-16)20(22)23-19-11-8-7-10-18(19)21(2,3)4/h7-8,10-11,16-17H,5-6,9,12-15H2,1-4H3 |
| InChIKey | ZXVPIAPBQJGWSR-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.48 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|