C19H28O2 — CID 114971124
(4-butylcyclohexyl)-(2-ethoxyphenyl)methanone (PubChem CID 114971124) has the molecular formula C19H28O2 and a molecular weight of 288.43 g/mol. Its IUPAC name is (4-butylcyclohexyl)-(2-ethoxyphenyl)methanone.
| Compound Name | (4-butylcyclohexyl)-(2-ethoxyphenyl)methanone |
|---|---|
| PubChem CID | 114971124 |
| Molecular Formula | C19H28O2 |
| Molecular Weight | 288.43 g/mol |
| Exact Mass | 288.21 |
| IUPAC Name | (4-butylcyclohexyl)-(2-ethoxyphenyl)methanone |
| SMILES | CCCCC1CCC(C(=O)c2ccccc2OCC)CC1 |
| InChI | InChI=1S/C19H28O2/c1-3-5-8-15-11-13-16(14-12-15)19(20)17-9-6-7-10-18(17)21-4-2/h6-7,9-10,15-16H,3-5,8,11-14H2,1-2H3 |
| InChIKey | YDFRXZHJNHCCPP-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.43 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |