C28H38N2O4 — CID 19207017
N-[4-[(4-butylcyclohexanecarbonyl)amino]-2,5-diethoxyphenyl]benzamide (PubChem CID 19207017) has the molecular formula C28H38N2O4 and a molecular weight of 466.62 g/mol. Its IUPAC name is N-[4-[(4-butylcyclohexanecarbonyl)amino]-2,5-diethoxyphenyl]benzamide.
| Compound Name | N-[4-[(4-butylcyclohexanecarbonyl)amino]-2,5-diethoxyphenyl]benzamide |
|---|---|
| PubChem CID | 19207017 |
| Molecular Formula | C28H38N2O4 |
| Molecular Weight | 466.62 g/mol |
| Exact Mass | 466.28 |
| IUPAC Name | N-[4-[(4-butylcyclohexanecarbonyl)amino]-2,5-diethoxyphenyl]benzamide |
| SMILES | CCCCC1CCC(C(=O)Nc2cc(OCC)c(NC(=O)c3ccccc3)cc2OCC)CC1 |
| InChI | InChI=1S/C28H38N2O4/c1-4-7-11-20-14-16-22(17-15-20)28(32)30-24-19-25(33-5-2)23(18-26(24)34-6-3)29-27(31)21-12-9-8-10-13-21/h8-10,12-13,18-20,22H,4-7,11,14-17H2,1-3H3,(H,29,31)(H,30,32) |
| InChIKey | NBVTWMULQAKYSD-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.62 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |