C21H32BrNO2 — CID 82259227
N-[4-(2-bromoethyl)-2-ethoxyphenyl]-4-butylcyclohexane-1-carboxamide (PubChem CID 82259227) has the molecular formula C21H32BrNO2 and a molecular weight of 410.40 g/mol. Its IUPAC name is N-[4-(2-bromoethyl)-2-ethoxyphenyl]-4-butylcyclohexane-1-carboxamide.
| Compound Name | N-[4-(2-bromoethyl)-2-ethoxyphenyl]-4-butylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 82259227 |
| Molecular Formula | C21H32BrNO2 |
| Molecular Weight | 410.40 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | N-[4-(2-bromoethyl)-2-ethoxyphenyl]-4-butylcyclohexane-1-carboxamide |
| SMILES | CCCCC1CCC(C(=O)Nc2ccc(CCBr)cc2OCC)CC1 |
| InChI | InChI=1S/C21H32BrNO2/c1-3-5-6-16-7-10-18(11-8-16)21(24)23-19-12-9-17(13-14-22)15-20(19)25-4-2/h9,12,15-16,18H,3-8,10-11,13-14H2,1-2H3,(H,23,24) |
| InChIKey | RUPKBJWQEBTPJT-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.40 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|