C17H26BrNO2 — CID 82259619
N-[4-(2-bromo-2-methylpropyl)-2-ethoxyphenyl]-2,2-dimethylpropanamide (PubChem CID 82259619) has the molecular formula C17H26BrNO2 and a molecular weight of 356.30 g/mol. Its IUPAC name is N-[4-(2-bromo-2-methylpropyl)-2-ethoxyphenyl]-2,2-dimethylpropanamide.
| Compound Name | N-[4-(2-bromo-2-methylpropyl)-2-ethoxyphenyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 82259619 |
| Molecular Formula | C17H26BrNO2 |
| Molecular Weight | 356.30 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | N-[4-(2-bromo-2-methylpropyl)-2-ethoxyphenyl]-2,2-dimethylpropanamide |
| SMILES | CCOc1cc(CC(C)(C)Br)ccc1NC(=O)C(C)(C)C |
| InChI | InChI=1S/C17H26BrNO2/c1-7-21-14-10-12(11-17(5,6)18)8-9-13(14)19-15(20)16(2,3)4/h8-10H,7,11H2,1-6H3,(H,19,20) |
| InChIKey | LEXXMIAKWATXSQ-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.30 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|