C18H27NO4 — CID 95414294
5-[4-(2,2-dimethylpropanoylamino)-3-ethoxyphenyl]pentanoic acid (PubChem CID 95414294) has the molecular formula C18H27NO4 and a molecular weight of 321.42 g/mol. Its IUPAC name is 5-[4-(2,2-dimethylpropanoylamino)-3-ethoxyphenyl]pentanoic acid.
| Compound Name | 5-[4-(2,2-dimethylpropanoylamino)-3-ethoxyphenyl]pentanoic acid |
|---|---|
| PubChem CID | 95414294 |
| Molecular Formula | C18H27NO4 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.19 |
| IUPAC Name | 5-[4-(2,2-dimethylpropanoylamino)-3-ethoxyphenyl]pentanoic acid |
| SMILES | CCOc1cc(CCCCC(=O)O)ccc1NC(=O)C(C)(C)C |
| InChI | InChI=1S/C18H27NO4/c1-5-23-15-12-13(8-6-7-9-16(20)21)10-11-14(15)19-17(22)18(2,3)4/h10-12H,5-9H2,1-4H3,(H,19,22)(H,20,21) |
| InChIKey | LRFDALWWIHQAHB-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|