C20H31NO2 — CID 57098277
(2-ethoxyphenyl)-[4-(2-methylpropylamino)cycloheptyl]methanone (PubChem CID 57098277) has the molecular formula C20H31NO2 and a molecular weight of 317.47 g/mol. Its IUPAC name is (2-ethoxyphenyl)-[4-(2-methylpropylamino)cycloheptyl]methanone.
| Compound Name | (2-ethoxyphenyl)-[4-(2-methylpropylamino)cycloheptyl]methanone |
|---|---|
| PubChem CID | 57098277 |
| Molecular Formula | C20H31NO2 |
| Molecular Weight | 317.47 g/mol |
| Exact Mass | 317.24 |
| IUPAC Name | (2-ethoxyphenyl)-[4-(2-methylpropylamino)cycloheptyl]methanone |
| SMILES | CCOc1ccccc1C(=O)C1CCCC(NCC(C)C)CC1 |
| InChI | InChI=1S/C20H31NO2/c1-4-23-19-11-6-5-10-18(19)20(22)16-8-7-9-17(13-12-16)21-14-15(2)3/h5-6,10-11,15-17,21H,4,7-9,12-14H2,1-3H3 |
| InChIKey | VBDAFAPMYNLATA-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.47 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |