C31H37F3O4 — CID 118891427
(4,5,6-trifluoro-7-propyl-9H-xanthen-3-yl) 4-(6-propyloxan-3-yl)cyclohexane-1-carboxylate (PubChem CID 118891427) has the molecular formula C31H37F3O4 and a molecular weight of 530.63 g/mol. Its IUPAC name is (4,5,6-trifluoro-7-propyl-9H-xanthen-3-yl) 4-(6-propyloxan-3-yl)cyclohexane-1-carboxylate.
| Compound Name | (4,5,6-trifluoro-7-propyl-9H-xanthen-3-yl) 4-(6-propyloxan-3-yl)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 118891427 |
| Molecular Formula | C31H37F3O4 |
| Molecular Weight | 530.63 g/mol |
| Exact Mass | 530.26 |
| IUPAC Name | (4,5,6-trifluoro-7-propyl-9H-xanthen-3-yl) 4-(6-propyloxan-3-yl)cyclohexane-1-carboxylate |
| SMILES | CCCc1cc2c(c(F)c1F)Oc1c(ccc(OC(=O)C3CCC(C4CCC(CCC)OC4)CC3)c1F)C2 |
| InChI | InChI=1S/C31H37F3O4/c1-3-5-20-15-23-16-21-12-14-25(27(33)29(21)38-30(23)28(34)26(20)32)37-31(35)19-9-7-18(8-10-19)22-11-13-24(6-4-2)36-17-22/h12,14-15,18-19,22,24H,3-11,13,16-17H2,1-2H3 |
| InChIKey | BJCGPVUNJTYXMM-UHFFFAOYSA-N |
| XLogP | 8.06 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.63 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|