C25H27F3O — CID 118891328
3,4,5-trifluoro-6-[4-[(E)-prop-1-enyl]cyclohexyl]-2-propyl-9H-xanthene (PubChem CID 118891328) has the molecular formula C25H27F3O and a molecular weight of 400.48 g/mol. Its IUPAC name is 3,4,5-trifluoro-6-[4-[(E)-prop-1-enyl]cyclohexyl]-2-propyl-9H-xanthene.
| Compound Name | 3,4,5-trifluoro-6-[4-[(E)-prop-1-enyl]cyclohexyl]-2-propyl-9H-xanthene |
|---|---|
| PubChem CID | 118891328 |
| Molecular Formula | C25H27F3O |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.20 |
| IUPAC Name | 3,4,5-trifluoro-6-[4-[(E)-prop-1-enyl]cyclohexyl]-2-propyl-9H-xanthene |
| SMILES | C/C=C/C1CCC(c2ccc3c(c2F)Oc2c(cc(CCC)c(F)c2F)C3)CC1 |
| InChI | InChI=1S/C25H27F3O/c1-3-5-15-7-9-16(10-8-15)20-12-11-18-14-19-13-17(6-4-2)21(26)23(28)25(19)29-24(18)22(20)27/h3,5,11-13,15-16H,4,6-10,14H2,1-2H3/b5-3+ |
| InChIKey | RJSCBBYSZUZIPU-HWKANZROSA-N |
| XLogP | 7.60 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|