C26H31F3O2 — CID 144734061
6-(4-butan-2-yloxy-3-methylbutyl)-2-but-3-enyl-3,4,5-trifluoro-9H-xanthene (PubChem CID 144734061) has the molecular formula C26H31F3O2 and a molecular weight of 432.53 g/mol. Its IUPAC name is 6-(4-butan-2-yloxy-3-methylbutyl)-2-but-3-enyl-3,4,5-trifluoro-9H-xanthene.
| Compound Name | 6-(4-butan-2-yloxy-3-methylbutyl)-2-but-3-enyl-3,4,5-trifluoro-9H-xanthene |
|---|---|
| PubChem CID | 144734061 |
| Molecular Formula | C26H31F3O2 |
| Molecular Weight | 432.53 g/mol |
| Exact Mass | 432.23 |
| IUPAC Name | 6-(4-butan-2-yloxy-3-methylbutyl)-2-but-3-enyl-3,4,5-trifluoro-9H-xanthene |
| SMILES | C=CCCc1cc2c(c(F)c1F)Oc1c(ccc(CCC(C)COC(C)CC)c1F)C2 |
| InChI | InChI=1S/C26H31F3O2/c1-5-7-8-19-13-21-14-20-12-11-18(10-9-16(3)15-30-17(4)6-2)23(28)25(20)31-26(21)24(29)22(19)27/h5,11-13,16-17H,1,6-10,14-15H2,2-4H3 |
| InChIKey | BTFWYNANXKGBFB-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.53 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|