C35H46F2O — CID 175392353
1-ethoxy-2,3-difluoro-4-(4-propylcyclohexyl)benzene;1-methyl-4-(4-pentylphenyl)benzene (PubChem CID 175392353) has the molecular formula C35H46F2O and a molecular weight of 520.75 g/mol. Its IUPAC name is 1-ethoxy-2,3-difluoro-4-(4-propylcyclohexyl)benzene;1-methyl-4-(4-pentylphenyl)benzene.
| Compound Name | 1-ethoxy-2,3-difluoro-4-(4-propylcyclohexyl)benzene;1-methyl-4-(4-pentylphenyl)benzene |
|---|---|
| PubChem CID | 175392353 |
| Molecular Formula | C35H46F2O |
| Molecular Weight | 520.75 g/mol |
| Exact Mass | 520.35 |
| IUPAC Name | 1-ethoxy-2,3-difluoro-4-(4-propylcyclohexyl)benzene;1-methyl-4-(4-pentylphenyl)benzene |
| SMILES | CCCC1CCC(c2ccc(OCC)c(F)c2F)CC1.CCCCCc1ccc(-c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C18H22.C17H24F2O/c1-3-4-5-6-16-9-13-18(14-10-16)17-11-7-15(2)8-12-17;1-3-5-12-6-8-13(9-7-12)14-10-11-15(20-4-2)17(19)16(14)18/h7-14H,3-6H2,1-2H3;10-13H,3-9H2,1-2H3 |
| InChIKey | ISDCFZGQLRRMOV-UHFFFAOYSA-N |
| XLogP | 10.83 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.75 |
| LogP ≤ 5 | 10.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|