C23H20F2OS — CID 174244267
2-[4-[4-(cyclopent-3-en-1-ylmethoxy)-2,3-difluorophenyl]phenyl]-5-methylthiophene (PubChem CID 174244267) has the molecular formula C23H20F2OS and a molecular weight of 382.48 g/mol. Its IUPAC name is 2-[4-[4-(cyclopent-3-en-1-ylmethoxy)-2,3-difluorophenyl]phenyl]-5-methylthiophene.
| Compound Name | 2-[4-[4-(cyclopent-3-en-1-ylmethoxy)-2,3-difluorophenyl]phenyl]-5-methylthiophene |
|---|---|
| PubChem CID | 174244267 |
| Molecular Formula | C23H20F2OS |
| Molecular Weight | 382.48 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | 2-[4-[4-(cyclopent-3-en-1-ylmethoxy)-2,3-difluorophenyl]phenyl]-5-methylthiophene |
| SMILES | Cc1ccc(-c2ccc(-c3ccc(OCC4CC=CC4)c(F)c3F)cc2)s1 |
| InChI | InChI=1S/C23H20F2OS/c1-15-6-13-21(27-15)18-9-7-17(8-10-18)19-11-12-20(23(25)22(19)24)26-14-16-4-2-3-5-16/h2-3,6-13,16H,4-5,14H2,1H3 |
| InChIKey | HQPSWAXBDLWXFO-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.48 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|