C21H16F3IOS — CID 172603684
2-[4-[4-(cyclobutylmethoxy)-2,3-difluorophenyl]-3-fluorophenyl]-5-iodothiophene (PubChem CID 172603684) has the molecular formula C21H16F3IOS and a molecular weight of 500.32 g/mol. Its IUPAC name is 2-[4-[4-(cyclobutylmethoxy)-2,3-difluorophenyl]-3-fluorophenyl]-5-iodothiophene.
| Compound Name | 2-[4-[4-(cyclobutylmethoxy)-2,3-difluorophenyl]-3-fluorophenyl]-5-iodothiophene |
|---|---|
| PubChem CID | 172603684 |
| Molecular Formula | C21H16F3IOS |
| Molecular Weight | 500.32 g/mol |
| Exact Mass | 499.99 |
| IUPAC Name | 2-[4-[4-(cyclobutylmethoxy)-2,3-difluorophenyl]-3-fluorophenyl]-5-iodothiophene |
| SMILES | Fc1cc(-c2ccc(I)s2)ccc1-c1ccc(OCC2CCC2)c(F)c1F |
| InChI | InChI=1S/C21H16F3IOS/c22-16-10-13(18-8-9-19(25)27-18)4-5-14(16)15-6-7-17(21(24)20(15)23)26-11-12-2-1-3-12/h4-10,12H,1-3,11H2 |
| InChIKey | DIZTXSOGRUDDCC-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.32 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|