C19H19F2IOS — CID 171813019
2-[4-(cyclopentylmethoxy)-2,3-difluorophenyl]-5-iodo-5,6-dihydro-4H-cyclopenta[b]thiophene (PubChem CID 171813019) has the molecular formula C19H19F2IOS and a molecular weight of 460.33 g/mol. Its IUPAC name is 2-[4-(cyclopentylmethoxy)-2,3-difluorophenyl]-5-iodo-5,6-dihydro-4H-cyclopenta[b]thiophene.
| Compound Name | 2-[4-(cyclopentylmethoxy)-2,3-difluorophenyl]-5-iodo-5,6-dihydro-4H-cyclopenta[b]thiophene |
|---|---|
| PubChem CID | 171813019 |
| Molecular Formula | C19H19F2IOS |
| Molecular Weight | 460.33 g/mol |
| Exact Mass | 460.02 |
| IUPAC Name | 2-[4-(cyclopentylmethoxy)-2,3-difluorophenyl]-5-iodo-5,6-dihydro-4H-cyclopenta[b]thiophene |
| SMILES | Fc1c(OCC2CCCC2)ccc(-c2cc3c(s2)CC(I)C3)c1F |
| InChI | InChI=1S/C19H19F2IOS/c20-18-14(17-8-12-7-13(22)9-16(12)24-17)5-6-15(19(18)21)23-10-11-3-1-2-4-11/h5-6,8,11,13H,1-4,7,9-10H2 |
| InChIKey | DFTZHTWLPRYVMS-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.33 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|