C17H17F3OS — CID 174243522
2-[2,3-difluoro-4-(3-fluoropropoxy)phenyl]-5-methyl-5,6-dihydro-4H-cyclopenta[b]thiophene (PubChem CID 174243522) has the molecular formula C17H17F3OS and a molecular weight of 326.38 g/mol. Its IUPAC name is 2-[2,3-difluoro-4-(3-fluoropropoxy)phenyl]-5-methyl-5,6-dihydro-4H-cyclopenta[b]thiophene.
| Compound Name | 2-[2,3-difluoro-4-(3-fluoropropoxy)phenyl]-5-methyl-5,6-dihydro-4H-cyclopenta[b]thiophene |
|---|---|
| PubChem CID | 174243522 |
| Molecular Formula | C17H17F3OS |
| Molecular Weight | 326.38 g/mol |
| Exact Mass | 326.10 |
| IUPAC Name | 2-[2,3-difluoro-4-(3-fluoropropoxy)phenyl]-5-methyl-5,6-dihydro-4H-cyclopenta[b]thiophene |
| SMILES | CC1Cc2cc(-c3ccc(OCCCF)c(F)c3F)sc2C1 |
| InChI | InChI=1S/C17H17F3OS/c1-10-7-11-9-15(22-14(11)8-10)12-3-4-13(17(20)16(12)19)21-6-2-5-18/h3-4,9-10H,2,5-8H2,1H3 |
| InChIKey | WWDYQOXMMHHZGV-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.38 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|